Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Isopropamide: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456925987 of page Isopropamide for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Citation bot (talk | contribs) Add: doi. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | #UCB_webform 1580/2023 |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Isopropamide|oldid=456925987}} 456925987] of page [[Isopropamide]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = |
||
| IUPAC_name = 4-amino-''N,N''-diisopropyl-''N''-methyl-4-oxo-3,3-diphenylbutan-1-aminium |
| IUPAC_name = 4-amino-''N,N''-diisopropyl-''N''-methyl-4-oxo-3,3-diphenylbutan-1-aminium |
||
| image = Isopropamide.png |
| image = Isopropamide.png |
||
| Line 14: | Line 15: | ||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
||
| legal_UK = <!-- GSL / P / POM / CD --> |
| legal_UK = <!-- GSL / P / POM / CD --> |
||
| legal_US = Rx-only |
| legal_US = Rx-only |
||
| legal_US_comment = and Unscheduled |
|||
| legal_status = Unscheduled |
| legal_status = Unscheduled |
||
| routes_of_administration = Oral |
| routes_of_administration = Oral |
||
| Line 23: | Line 25: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite||??}} |
||
| CAS_number = |
| CAS_number = -- |
||
| ATC_prefix = A03 |
| ATC_prefix = A03 |
||
| ATC_suffix = AB09 |
| ATC_suffix = AB09 |
||
| PubChem = 3775 |
| PubChem = 3775 |
||
| DrugBank_Ref = {{drugbankcite| |
| DrugBank_Ref = {{drugbankcite||drugbank}} |
||
| DrugBank = DB01625 |
| DrugBank = DB01625 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 3643 |
| ChemSpiderID = 3643 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite||FDA}} |
||
| UNII = 8B9I31H724 |
| UNII = 8B9I31H724 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1201232 |
||
| ⚫ | |||
<!--Chemical data--> |
|||
| molecular_weight = 353.52092 g/mol |
|||
| ⚫ | |||
| smiles = O=C(N)C(c1ccccc1)(c2ccccc2)CC[N+](C(C)C)(C(C)C)C |
| smiles = O=C(N)C(c1ccccc1)(c2ccccc2)CC[N+](C(C)C)(C(C)C)C |
||
| InChI = 1/C23H32N2O/c1-18(2)25(5,19(3)4)17-16-23(22(24)26,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3,(H-,24,26)/p+1 |
|||
| InChIKey = JTPUMZTWMWIVPA-IKLDFBCSAQ |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C23H32N2O/c1-18(2)25(5,19(3)4)17-16-23(22(24)26,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3,(H-,24,26)/p+1 |
| StdInChI = 1S/C23H32N2O/c1-18(2)25(5,19(3)4)17-16-23(22(24)26,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3,(H-,24,26)/p+1 |
||
| Line 49: | Line 50: | ||
| StdInChIKey = JTPUMZTWMWIVPA-UHFFFAOYSA-O |
| StdInChIKey = JTPUMZTWMWIVPA-UHFFFAOYSA-O |
||
}} |
}} |
||
'''Isopropamide''' ('''R79''') is a long-acting [[anticholinergic]] [[drug]]. It is used in the treatment of [[peptic ulcer]]s and other [[gastrointestinal disorder]]s involving hyperacidity (gastrointestinal [[acidosis]]) and hypermotility. Chemically, it contains a [[quaternary ammonium]] group. It is most often provided as an [[iodide]] salt, but is also available as a bromide or chloride salt. It was discovered at [[Janssen Pharmaceutica]] in 1954. |
|||
==References== |
|||
{{Reflist}} |
|||
== Further reading == |
|||
{{refbegin}} |
|||
* {{cite journal | vauthors = Seeherman R | title = Isopropamide iodide: a long-acting anticholinergic | journal = Delaware Medical Journal | volume = 29 | issue = 10 | pages = 265–9 | date = October 1957 | pmid = 13473394 }} |
|||
* {{cite journal | vauthors = Boss Jr EG, Buchanan GC | title = Effect of isopropamide iodide on basal gastric secretion in the human | journal = Gastroenterology | volume = 33 | issue = 5 | pages = 730–6 | date = November 1957 | doi = 10.1016/S0016-5085(19)35625-2 | pmid = 13480414 }} |
|||
{{refend}} |
|||
{{Drugs for functional gastrointestinal disorders}} |
|||
{{Muscarinic acetylcholine receptor modulators}} |
|||
[[Category:Muscarinic antagonists]] |
|||
[[Category:Quaternary ammonium compounds]] |
|||
[[Category:Carboxamides]] |
|||
[[Category:Janssen Pharmaceutica]] |
|||
[[Category:Belgian inventions]] |
|||
[[Category:Diisopropylamino compounds]] |
|||
{{gastrointestinal-drug-stub}} |
|||